About 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide
5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide (PubChem CID 24993287) has the molecular formula C20H17ClN4O2S
and a molecular weight of 412.90 g/mol. Its IUPAC name is 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide |
| PubChem CID | 24993287 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide |
| SMILES | CC(Oc1cc(-c2cnc3cc(N)ccn23)sc1C(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN4O2S/c1-11(13-4-2-3-5-14(13)21)27-16-9-17(28-19(16)20(23)26)15-10-24-18-8-12(22)6-7-25(15)18/h2-11H,22H2,1H3,(H2,23,26) |
| InChIKey | YYZJBDSLTOJDSZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide?
The IUPAC name of 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide (CID 24993287) is 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide.
What is the SMILES notation for 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide?
The canonical SMILES for 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide is CC(Oc1cc(-c2cnc3cc(N)ccn23)sc1C(N)=O)c1ccccc1Cl.
What is the InChIKey of 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide?
The InChIKey is YYZJBDSLTOJDSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN4O2S/c1-11(13-4-2-3-5-14(13)21)27-16-9-17(28-19(16)20(23)26)15-10-24-18-8-12(22)6-7-25(15)18/h2-11H,22H2,1H3,(H2,23,26).
What are the key properties of 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide?
5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide has a molecular weight of 412.90 g/mol, XLogP of 4.54, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-aminoimidazo[1,2-a]pyridin-3-yl)-3-[1-(2-chlorophenyl)ethoxy]thiophene-2-carboxamide is sourced from PubChem (CID 24993287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).