About 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate
4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate (PubChem CID 24993360) has the molecular formula C20H27NO3
and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate.
Molecular Properties
| Compound Name | 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate |
| PubChem CID | 24993360 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate |
| SMILES | O=COCCCCN1CCC(C2CC(=O)c3ccccc3C2)CC1 |
| InChI | InChI=1S/C20H27NO3/c22-15-24-12-4-3-9-21-10-7-16(8-11-21)18-13-17-5-1-2-6-19(17)20(23)14-18/h1-2,5-6,15-16,18H,3-4,7-14H2 |
| InChIKey | RIEPLTTWRDAPFR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate?
The IUPAC name of 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate (CID 24993360) is 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate.
What is the SMILES notation for 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate?
The canonical SMILES for 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate is O=COCCCCN1CCC(C2CC(=O)c3ccccc3C2)CC1.
What is the InChIKey of 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate?
The InChIKey is RIEPLTTWRDAPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO3/c22-15-24-12-4-3-9-21-10-7-16(8-11-21)18-13-17-5-1-2-6-19(17)20(23)14-18/h1-2,5-6,15-16,18H,3-4,7-14H2.
What are the key properties of 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate?
4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate has a molecular weight of 329.44 g/mol, XLogP of 3.10, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-oxo-2,3-dihydro-1H-naphthalen-2-yl)piperidin-1-yl]butyl formate is sourced from PubChem (CID 24993360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).