C18H19ClN4OS — CID 24993446
N-(1-amino-3-phenylpropan-2-yl)-5-chloro-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide (PubChem CID 24993446) has the molecular formula C18H19ClN4OS and a molecular weight of 374.90 g/mol. Its IUPAC name is N-(1-amino-3-phenylpropan-2-yl)-5-chloro-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide.
| Compound Name | N-(1-amino-3-phenylpropan-2-yl)-5-chloro-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24993446 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-(1-amino-3-phenylpropan-2-yl)-5-chloro-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide |
| SMILES | Cn1nccc1-c1cc(C(=O)NC(CN)Cc2ccccc2)sc1Cl |
| InChI | InChI=1S/C18H19ClN4OS/c1-23-15(7-8-21-23)14-10-16(25-17(14)19)18(24)22-13(11-20)9-12-5-3-2-4-6-12/h2-8,10,13H,9,11,20H2,1H3,(H,22,24) |
| InChIKey | FNROVLCSVCNVCA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |