C28H29NO4 — CID 24993586
1-[4-methyl-7-(3-phenylbutoxy)-6-(2-pyridin-2-ylethoxy)-1-benzofuran-5-yl]ethanone (PubChem CID 24993586) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 1-[4-methyl-7-(3-phenylbutoxy)-6-(2-pyridin-2-ylethoxy)-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[4-methyl-7-(3-phenylbutoxy)-6-(2-pyridin-2-ylethoxy)-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 24993586 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[4-methyl-7-(3-phenylbutoxy)-6-(2-pyridin-2-ylethoxy)-1-benzofuran-5-yl]ethanone |
| SMILES | CC(=O)c1c(OCCc2ccccn2)c(OCCC(C)c2ccccc2)c2occc2c1C |
| InChI | InChI=1S/C28H29NO4/c1-19(22-9-5-4-6-10-22)12-16-33-28-26-24(14-18-31-26)20(2)25(21(3)30)27(28)32-17-13-23-11-7-8-15-29-23/h4-11,14-15,18-19H,12-13,16-17H2,1-3H3 |
| InChIKey | KQZXLVDEGZGJHD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |