C20H15FN4S2 — CID 24993656
5-[2-[(2-fluoro-4-pyridinyl)methylsulfanyl]phenyl]-N-phenyl-1,3,4-thiadiazol-2-amine (PubChem CID 24993656) has the molecular formula C20H15FN4S2 and a molecular weight of 394.50 g/mol. Its IUPAC name is 5-[2-[(2-fluoro-4-pyridinyl)methylsulfanyl]phenyl]-N-phenyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-[(2-fluoro-4-pyridinyl)methylsulfanyl]phenyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 24993656 |
| Molecular Formula | C20H15FN4S2 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 5-[2-[(2-fluoro-4-pyridinyl)methylsulfanyl]phenyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1cc(CSc2ccccc2-c2nnc(Nc3ccccc3)s2)ccn1 |
| InChI | InChI=1S/C20H15FN4S2/c21-18-12-14(10-11-22-18)13-26-17-9-5-4-8-16(17)19-24-25-20(27-19)23-15-6-2-1-3-7-15/h1-12H,13H2,(H,23,25) |
| InChIKey | MEERXKGAIPDZTG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|