About ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate
ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate (PubChem CID 24993827) has the molecular formula C13H15N5O2
and a molecular weight of 273.30 g/mol. Its IUPAC name is ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
| PubChem CID | 24993827 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C)c2c1CCc1cnc(N)nc1-2 |
| InChI | InChI=1S/C13H15N5O2/c1-3-20-12(19)10-8-5-4-7-6-15-13(14)16-9(7)11(8)18(2)17-10/h6H,3-5H2,1-2H3,(H2,14,15,16) |
| InChIKey | GUAHQNVJSKHHDA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
The IUPAC name of ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate (CID 24993827) is ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate.
What is the SMILES notation for ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
The canonical SMILES for ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate is CCOC(=O)c1nn(C)c2c1CCc1cnc(N)nc1-2.
What is the InChIKey of ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
The InChIKey is GUAHQNVJSKHHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2/c1-3-20-12(19)10-8-5-4-7-6-15-13(14)16-9(7)11(8)18(2)17-10/h6H,3-5H2,1-2H3,(H2,14,15,16).
What are the key properties of ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate?
ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate has a molecular weight of 273.30 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-amino-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate is sourced from PubChem (CID 24993827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).