C22H21N5O4 — CID 24993895
3-[5-(3,4,5-trimethoxyanilino)pyrazolo[1,5-a]pyrimidin-3-yl]benzamide (PubChem CID 24993895) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-[5-(3,4,5-trimethoxyanilino)pyrazolo[1,5-a]pyrimidin-3-yl]benzamide.
| Compound Name | 3-[5-(3,4,5-trimethoxyanilino)pyrazolo[1,5-a]pyrimidin-3-yl]benzamide |
|---|---|
| PubChem CID | 24993895 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-[5-(3,4,5-trimethoxyanilino)pyrazolo[1,5-a]pyrimidin-3-yl]benzamide |
| SMILES | COc1cc(Nc2ccn3ncc(-c4cccc(C(N)=O)c4)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N5O4/c1-29-17-10-15(11-18(30-2)20(17)31-3)25-19-7-8-27-22(26-19)16(12-24-27)13-5-4-6-14(9-13)21(23)28/h4-12H,1-3H3,(H2,23,28)(H,25,26) |
| InChIKey | KCYJGWCQNXFEEU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |