C22H21N5O3 — CID 24994153
1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(1,2,4-triazol-1-yl)phenyl]ethane-1,2-dione (PubChem CID 24994153) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(1,2,4-triazol-1-yl)phenyl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(1,2,4-triazol-1-yl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 24994153 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(1,2,4-triazol-1-yl)phenyl]ethane-1,2-dione |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C22H21N5O3/c1-16-13-25(21(29)18-5-3-2-4-6-18)11-12-26(16)22(30)20(28)17-7-9-19(10-8-17)27-15-23-14-24-27/h2-10,14-16H,11-13H2,1H3 |
| InChIKey | XECGARSGBUCPLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|