C22H22N2O4 — CID 24995152
2-[4-[4-(2,1-benzoxazole-3-carbonylamino)phenyl]cyclohexyl]acetic acid (PubChem CID 24995152) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[4-[4-(2,1-benzoxazole-3-carbonylamino)phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-(2,1-benzoxazole-3-carbonylamino)phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 24995152 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[4-[4-(2,1-benzoxazole-3-carbonylamino)phenyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(c2ccc(NC(=O)c3onc4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C22H22N2O4/c25-20(26)13-14-5-7-15(8-6-14)16-9-11-17(12-10-16)23-22(27)21-18-3-1-2-4-19(18)24-28-21/h1-4,9-12,14-15H,5-8,13H2,(H,23,27)(H,25,26) |
| InChIKey | VQXJUIMROHETQI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |