C35H38Br2O5 — CID 24995479
(12-bromo-9-hydroxy-1,6a,6b,8a,11,14a-hexamethyl-2,10-dioxo-7,8,9,11,12,12a,13,14-octahydropicen-3-yl) 4-bromobenzoate (PubChem CID 24995479) has the molecular formula C35H38Br2O5 and a molecular weight of 698.49 g/mol. Its IUPAC name is (12-bromo-9-hydroxy-1,6a,6b,8a,11,14a-hexamethyl-2,10-dioxo-7,8,9,11,12,12a,13,14-octahydropicen-3-yl) 4-bromobenzoate.
| Compound Name | (12-bromo-9-hydroxy-1,6a,6b,8a,11,14a-hexamethyl-2,10-dioxo-7,8,9,11,12,12a,13,14-octahydropicen-3-yl) 4-bromobenzoate |
|---|---|
| PubChem CID | 24995479 |
| Molecular Formula | C35H38Br2O5 |
| Molecular Weight | 698.49 g/mol |
| Exact Mass | 696.11 |
| IUPAC Name | (12-bromo-9-hydroxy-1,6a,6b,8a,11,14a-hexamethyl-2,10-dioxo-7,8,9,11,12,12a,13,14-octahydropicen-3-yl) 4-bromobenzoate |
| SMILES | CC1=C2C(=CC=C3C2(C)CCC2(C)C4C(Br)C(C)C(=O)C(O)C4(C)CCC32C)C=C(OC(=O)c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C35H38Br2O5/c1-18-25-21(17-23(27(18)38)42-31(41)20-7-10-22(36)11-8-20)9-12-24-32(25,3)13-16-35(6)29-26(37)19(2)28(39)30(40)33(29,4)14-15-34(24,35)5/h7-12,17,19,26,29-30,40H,13-16H2,1-6H3 |
| InChIKey | GFJCUTGYKFGMKY-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.49 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|