About 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one
7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one (PubChem CID 24995912) has the molecular formula C22H17Cl2NO2
and a molecular weight of 398.29 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one.
Molecular Properties
| Compound Name | 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one |
| PubChem CID | 24995912 |
| Molecular Formula | C22H17Cl2NO2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one |
| SMILES | CC1(C)CC(=O)c2cc(-c3ccc(Cl)cc3)c(-c3ccccc3Cl)nc2O1 |
| InChI | InChI=1S/C22H17Cl2NO2/c1-22(2)12-19(26)17-11-16(13-7-9-14(23)10-8-13)20(25-21(17)27-22)15-5-3-4-6-18(15)24/h3-11H,12H2,1-2H3 |
| InChIKey | VGGJZHQRPQJWBN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one?
The IUPAC name of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one (CID 24995912) is 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one.
What is the SMILES notation for 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one?
The canonical SMILES for 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one is CC1(C)CC(=O)c2cc(-c3ccc(Cl)cc3)c(-c3ccccc3Cl)nc2O1.
What is the InChIKey of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one?
The InChIKey is VGGJZHQRPQJWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2NO2/c1-22(2)12-19(26)17-11-16(13-7-9-14(23)10-8-13)20(25-21(17)27-22)15-5-3-4-6-18(15)24/h3-11H,12H2,1-2H3.
What are the key properties of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one?
7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one has a molecular weight of 398.29 g/mol, XLogP of 6.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2,2-dimethyl-3H-pyrano[2,3-b]pyridin-4-one is sourced from PubChem (CID 24995912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).