About 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide
2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide (PubChem CID 24995997) has the molecular formula C22H16Cl3N3O2
and a molecular weight of 460.75 g/mol. Its IUPAC name is 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide.
Molecular Properties
| Compound Name | 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide |
| PubChem CID | 24995997 |
| Molecular Formula | C22H16Cl3N3O2 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccccc1-c1nc2cccc(Cl)c2n1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H16Cl3N3O2/c23-15-6-3-7-16(24)14(15)11-28-21-17(25)8-4-9-18(21)27-22(28)13-5-1-2-10-19(13)30-12-20(26)29/h1-10H,11-12H2,(H2,26,29) |
| InChIKey | WFMQIEAQFPXLGJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide?
The IUPAC name of 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide (CID 24995997) is 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide.
What is the SMILES notation for 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide?
The canonical SMILES for 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide is NC(=O)COc1ccccc1-c1nc2cccc(Cl)c2n1Cc1c(Cl)cccc1Cl.
What is the InChIKey of 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide?
The InChIKey is WFMQIEAQFPXLGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl3N3O2/c23-15-6-3-7-16(24)14(15)11-28-21-17(25)8-4-9-18(21)27-22(28)13-5-1-2-10-19(13)30-12-20(26)29/h1-10H,11-12H2,(H2,26,29).
What are the key properties of 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide?
2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide has a molecular weight of 460.75 g/mol, XLogP of 5.58, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[7-chloro-1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]phenoxy]acetamide is sourced from PubChem (CID 24995997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).