C30H54O4 — CID 24996188
16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadecanoic acid (PubChem CID 24996188) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is 16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadecanoic acid.
| Compound Name | 16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadecanoic acid |
|---|---|
| PubChem CID | 24996188 |
| Molecular Formula | C30H54O4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | 16-(6-ethoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadecanoic acid |
| SMILES | CCOC1=C(C)C(C)CC=C1CCC(C)CCCC(C)CCCC(C)(O)CCCC(C)C(=O)O |
| InChI | InChI=1S/C30H54O4/c1-8-34-28-26(6)24(4)17-19-27(28)18-16-23(3)13-9-12-22(2)14-10-20-30(7,33)21-11-15-25(5)29(31)32/h19,22-25,33H,8-18,20-21H2,1-7H3,(H,31,32) |
| InChIKey | AMEKGUUYCGQWIG-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |