About 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid
5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid (PubChem CID 24996583) has the molecular formula C19H15F6NO4
and a molecular weight of 435.32 g/mol. Its IUPAC name is 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid.
Molecular Properties
| Compound Name | 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid |
| PubChem CID | 24996583 |
| Molecular Formula | C19H15F6NO4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid |
| SMILES | CCC(=O)Nc1ccc(COc2ccc(C(F)(F)F)c(C(F)(F)F)c2)cc1C(=O)O |
| InChI | InChI=1S/C19H15F6NO4/c1-2-16(27)26-15-6-3-10(7-12(15)17(28)29)9-30-11-4-5-13(18(20,21)22)14(8-11)19(23,24)25/h3-8H,2,9H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | NMMVXNICYMIHTB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid?
The IUPAC name of 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid (CID 24996583) is 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid.
What is the SMILES notation for 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid?
The canonical SMILES for 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid is CCC(=O)Nc1ccc(COc2ccc(C(F)(F)F)c(C(F)(F)F)c2)cc1C(=O)O.
What is the InChIKey of 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid?
The InChIKey is NMMVXNICYMIHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F6NO4/c1-2-16(27)26-15-6-3-10(7-12(15)17(28)29)9-30-11-4-5-13(18(20,21)22)14(8-11)19(23,24)25/h3-8H,2,9H2,1H3,(H,26,27)(H,28,29).
What are the key properties of 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid?
5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid has a molecular weight of 435.32 g/mol, XLogP of 5.35, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3,4-bis(trifluoromethyl)phenoxy]methyl]-2-(propanoylamino)benzoic acid is sourced from PubChem (CID 24996583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).