C34H33Cl3N2O3 — CID 24996887
N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-2,2-dimethyl-3-phenylmethoxypropanamide (PubChem CID 24996887) has the molecular formula C34H33Cl3N2O3 and a molecular weight of 624.01 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-2,2-dimethyl-3-phenylmethoxypropanamide.
| Compound Name | N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-2,2-dimethyl-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 24996887 |
| Molecular Formula | C34H33Cl3N2O3 |
| Molecular Weight | 624.01 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | N-[6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-2,2-dimethyl-3-phenylmethoxypropanamide |
| SMILES | CC1(C)CC(NC(=O)C(C)(C)COCc2ccccc2)c2cc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3Cl)nc2O1 |
| InChI | InChI=1S/C34H33Cl3N2O3/c1-33(2,20-41-19-21-8-6-5-7-9-21)32(40)38-29-18-34(3,4)42-31-27(29)17-26(22-10-12-23(35)13-11-22)30(39-31)25-15-14-24(36)16-28(25)37/h5-17,29H,18-20H2,1-4H3,(H,38,40) |
| InChIKey | GALROZCSQAVJHJ-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.01 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |