C23H44O3Si — CID 24997217
3-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propyl acetate (PubChem CID 24997217) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is 3-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propyl acetate.
| Compound Name | 3-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propyl acetate |
|---|---|
| PubChem CID | 24997217 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | 3-[(1R,2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propyl acetate |
| SMILES | CC(=O)OCCC[C@@H]1C(=C(C)C)CC[C@@H](C)[C@@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si/c1-17(2)20-14-13-18(3)23(8,16-26-27(9,10)22(5,6)7)21(20)12-11-15-25-19(4)24/h18,21H,11-16H2,1-10H3/t18-,21-,23-/m1/s1 |
| InChIKey | CBSVNQQZUZXCAR-JMUQELJHSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|