C48H52F2O11S2 — CID 24997615
bis((2S,3R,4R,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol);hydrate (PubChem CID 24997615) has the molecular formula C48H52F2O11S2 and a molecular weight of 907.06 g/mol. Its IUPAC name is bis((2S,3R,4R,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol);hydrate.
| Compound Name | bis((2S,3R,4R,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol);hydrate |
|---|---|
| PubChem CID | 24997615 |
| Molecular Formula | C48H52F2O11S2 |
| Molecular Weight | 907.06 g/mol |
| Exact Mass | 906.29 |
| IUPAC Name | bis((2S,3R,4R,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol);hydrate |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(-c2ccc(F)cc2)s1.Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(-c2ccc(F)cc2)s1.O |
| InChI | InChI=1S/2C24H25FO5S.H2O/c2*1-13-2-3-15(24-23(29)22(28)21(27)19(12-26)30-24)10-16(13)11-18-8-9-20(31-18)14-4-6-17(25)7-5-14;/h2*2-10,19,21-24,26-29H,11-12H2,1H3;1H2/t2*19-,21-,22+,23-,24+;/m11./s1 |
| InChIKey | VHOFTEAWFCUTOS-TUGBYPPCSA-N |
| XLogP | 5.11 |
| TPSA | 211.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.06 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |