C32H35F2N5O3 — CID 24997669
1-N-butyl-3-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide (PubChem CID 24997669) has the molecular formula C32H35F2N5O3 and a molecular weight of 575.66 g/mol. Its IUPAC name is 1-N-butyl-3-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-3-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 24997669 |
| Molecular Formula | C32H35F2N5O3 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 1-N-butyl-3-N-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide |
| SMILES | CCCCN(C)C(=O)n1cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)C2Cc3ccccc3CN2)c2cccnc21 |
| InChI | InChI=1S/C32H35F2N5O3/c1-3-4-12-38(2)32(42)39-19-26(25-10-7-11-35-30(25)39)31(41)37-28(15-20-13-23(33)17-24(34)14-20)29(40)27-16-21-8-5-6-9-22(21)18-36-27/h5-11,13-14,17,19,27-29,36,40H,3-4,12,15-16,18H2,1-2H3,(H,37,41)/t27?,28-,29+/m0/s1 |
| InChIKey | FYMFLFJIGGNMRC-CVWZLOPKSA-N |
| XLogP | 4.43 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |