C14H14Cl2N4O4S — CID 24997852
(1S,2S,3R)-1-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]butane-1,2,3,4-tetrol (PubChem CID 24997852) has the molecular formula C14H14Cl2N4O4S and a molecular weight of 405.26 g/mol. Its IUPAC name is (1S,2S,3R)-1-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]butane-1,2,3,4-tetrol.
| Compound Name | (1S,2S,3R)-1-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 24997852 |
| Molecular Formula | C14H14Cl2N4O4S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | (1S,2S,3R)-1-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]butane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)c1nnc2n1N=C(c1ccc(Cl)cc1Cl)CS2 |
| InChI | InChI=1S/C14H14Cl2N4O4S/c15-6-1-2-7(8(16)3-6)9-5-25-14-18-17-13(20(14)19-9)12(24)11(23)10(22)4-21/h1-3,10-12,21-24H,4-5H2/t10-,11-,12-/m1/s1 |
| InChIKey | NKLAPTTZGFCUKT-IJLUTSLNSA-N |
| XLogP | 0.69 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |