C23H24ClN3O2 — CID 24998281
6-chloro-N,N,2',3'-tetramethylspiro[1,2-dihydroindene-3,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide (PubChem CID 24998281) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 6-chloro-N,N,2',3'-tetramethylspiro[1,2-dihydroindene-3,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide.
| Compound Name | 6-chloro-N,N,2',3'-tetramethylspiro[1,2-dihydroindene-3,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide |
|---|---|
| PubChem CID | 24998281 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 6-chloro-N,N,2',3'-tetramethylspiro[1,2-dihydroindene-3,8'-6,7-dihydropyrano[2,3-e]benzimidazole]-5'-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)N(C)C)cc2n1C)CCC1(CCc2cc(Cl)ccc21)O3 |
| InChI | InChI=1S/C23H24ClN3O2/c1-13-25-20-19(27(13)4)12-17(22(28)26(2)3)16-8-10-23(29-21(16)20)9-7-14-11-15(24)5-6-18(14)23/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | ABUPERYSQXIXQP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |