C31H47N5O5S — CID 24998307
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 24998307) has the molecular formula C31H47N5O5S and a molecular weight of 601.81 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24998307 |
| Molecular Formula | C31H47N5O5S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.33 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@H](CC1CCCCC1)NC(=O)c1cccnc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C31H47N5O5S/c1-23(2)21-36(42(40,41)28-15-13-26(32)14-16-28)27(22-37)12-6-7-18-34-31(39)29(19-24-9-4-3-5-10-24)35-30(38)25-11-8-17-33-20-25/h8,11,13-17,20,23-24,27,29,37H,3-7,9-10,12,18-19,21-22,32H2,1-2H3,(H,34,39)(H,35,38)/t27-,29-/m0/s1 |
| InChIKey | NIQQXGQUHFDUNP-YTMVLYRLSA-N |
| XLogP | 3.73 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|