C24H28N6O3 — CID 24998583
1-(3,3-dimethyl-1,2-dihydroindol-6-yl)-3-[4-[2-(3-hydroxypropylamino)pyrimidin-4-yl]oxyphenyl]urea (PubChem CID 24998583) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-(3,3-dimethyl-1,2-dihydroindol-6-yl)-3-[4-[2-(3-hydroxypropylamino)pyrimidin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(3,3-dimethyl-1,2-dihydroindol-6-yl)-3-[4-[2-(3-hydroxypropylamino)pyrimidin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 24998583 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-(3,3-dimethyl-1,2-dihydroindol-6-yl)-3-[4-[2-(3-hydroxypropylamino)pyrimidin-4-yl]oxyphenyl]urea |
| SMILES | CC1(C)CNc2cc(NC(=O)Nc3ccc(Oc4ccnc(NCCCO)n4)cc3)ccc21 |
| InChI | InChI=1S/C24H28N6O3/c1-24(2)15-27-20-14-17(6-9-19(20)24)29-23(32)28-16-4-7-18(8-5-16)33-21-10-12-26-22(30-21)25-11-3-13-31/h4-10,12,14,27,31H,3,11,13,15H2,1-2H3,(H,25,26,30)(H2,28,29,32) |
| InChIKey | SLZWAIUXXUJARF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|