C27H30BF4N3OSi — CID 24998754
[diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane tetrafluoroborate (PubChem CID 24998754) has the molecular formula C27H30BF4N3OSi and a molecular weight of 527.45 g/mol. Its IUPAC name is [diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane tetrafluoroborate.
| Compound Name | [diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane tetrafluoroborate |
|---|---|
| PubChem CID | 24998754 |
| Molecular Formula | C27H30BF4N3OSi |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | [diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane tetrafluoroborate |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@@H]1CCc2nn(-c3ccccc3)c[n+]21.F[B-](F)(F)F |
| InChI | InChI=1S/C27H30N3OSi.BF4/c1-32(2,3)31-27(22-13-7-4-8-14-22,23-15-9-5-10-16-23)25-19-20-26-28-30(21-29(25)26)24-17-11-6-12-18-24;2-1(3,4)5/h4-18,21,25H,19-20H2,1-3H3;/q+1;-1/t25-;/m0./s1 |
| InChIKey | KEOIBAIUDFKSPT-UQIIZPHYSA-N |
| XLogP | 6.74 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|