C29H35FN4O5 — CID 24998902
[6-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]hexanoylamino] cyclohexanecarboxylate (PubChem CID 24998902) has the molecular formula C29H35FN4O5 and a molecular weight of 538.62 g/mol. Its IUPAC name is [6-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]hexanoylamino] cyclohexanecarboxylate.
| Compound Name | [6-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]hexanoylamino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 24998902 |
| Molecular Formula | C29H35FN4O5 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [6-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]hexanoylamino] cyclohexanecarboxylate |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)NCCCCCC(=O)NOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C29H35FN4O5/c1-17-24(16-22-21-15-20(30)12-13-23(21)33-27(22)36)32-18(2)26(17)28(37)31-14-8-4-7-11-25(35)34-39-29(38)19-9-5-3-6-10-19/h12-13,15-16,19,32H,3-11,14H2,1-2H3,(H,31,37)(H,33,36)(H,34,35)/b22-16- |
| InChIKey | YOCHJLQJLBSUSC-JWGURIENSA-N |
| XLogP | 4.71 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|