About OZ-439
OZ-439 (PubChem CID 24999143) has the molecular formula C28H39NO5
and a molecular weight of 469.62 g/mol.
Molecular Properties
| Compound Name | OZ-439 |
| PubChem CID | 24999143 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | — |
| SMILES | c1cc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C28H39NO5/c1-3-26(31-14-11-29-9-12-30-13-10-29)4-2-22(1)23-5-7-27(8-6-23)32-28(34-33-27)24-16-20-15-21(18-24)19-25(28)17-20/h1-4,20-21,23-25H,5-19H2 |
| InChIKey | XLCNVWUKICLURR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze OZ-439 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of OZ-439?
The IUPAC name of OZ-439 (CID 24999143) is not available.
What is the SMILES notation for OZ-439?
The canonical SMILES for OZ-439 is c1cc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)ccc1OCCN1CCOCC1.
What is the InChIKey of OZ-439?
The InChIKey is XLCNVWUKICLURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H39NO5/c1-3-26(31-14-11-29-9-12-30-13-10-29)4-2-22(1)23-5-7-27(8-6-23)32-28(34-33-27)24-16-20-15-21(18-24)19-25(28)17-20/h1-4,20-21,23-25H,5-19H2.
What are the key properties of OZ-439?
OZ-439 has a molecular weight of 469.62 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for OZ-439 is sourced from PubChem (CID 24999143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).