About CID 24999450
CID 24999450 (PubChem CID 24999450) has the molecular formula C27H37NO4
and a molecular weight of 439.60 g/mol.
Molecular Properties
| Compound Name | CID 24999450 |
| PubChem CID | 24999450 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | — |
| SMILES | c1cc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)ccc1OC1CCNCC1 |
| InChI | InChI=1S/C27H37NO4/c1-3-24(29-25-7-11-28-12-8-25)4-2-20(1)21-5-9-26(10-6-21)30-27(32-31-26)22-14-18-13-19(16-22)17-23(27)15-18/h1-4,18-19,21-23,25,28H,5-17H2 |
| InChIKey | PPLHLYORLMAOKP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 24999450 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24999450?
The IUPAC name of CID 24999450 (CID 24999450) is not available.
What is the SMILES notation for CID 24999450?
The canonical SMILES for CID 24999450 is c1cc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)ccc1OC1CCNCC1.
What is the InChIKey of CID 24999450?
The InChIKey is PPLHLYORLMAOKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H37NO4/c1-3-24(29-25-7-11-28-12-8-25)4-2-20(1)21-5-9-26(10-6-21)30-27(32-31-26)22-14-18-13-19(16-22)17-23(27)15-18/h1-4,18-19,21-23,25,28H,5-17H2.
What are the key properties of CID 24999450?
CID 24999450 has a molecular weight of 439.60 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24999450 is sourced from PubChem (CID 24999450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).