C24H31BrN2O — CID 25000134
N-[5-(4-bromoanilino)-1,3-dimethyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3,3-dimethylbutanamide (PubChem CID 25000134) has the molecular formula C24H31BrN2O and a molecular weight of 443.43 g/mol. Its IUPAC name is N-[5-(4-bromoanilino)-1,3-dimethyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[5-(4-bromoanilino)-1,3-dimethyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 25000134 |
| Molecular Formula | C24H31BrN2O |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[5-(4-bromoanilino)-1,3-dimethyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc2c(c(C)c1NC(=O)CC(C)(C)C)CCCC2Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H31BrN2O/c1-15-13-20-19(16(2)23(15)27-22(28)14-24(3,4)5)7-6-8-21(20)26-18-11-9-17(25)10-12-18/h9-13,21,26H,6-8,14H2,1-5H3,(H,27,28) |
| InChIKey | NUWYIRQVINNCFM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |