About 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide
3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide (PubChem CID 25000274) has the molecular formula C24H22ClF4NO
and a molecular weight of 451.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide |
| PubChem CID | 25000274 |
| Molecular Formula | C24H22ClF4NO |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide |
| SMILES | O=C(NC(F)(F)c1ccc(F)c(F)c1)C12CC3CC(C1)CC(c1ccc(Cl)cc1)(C3)C2 |
| InChI | InChI=1S/C24H22ClF4NO/c25-18-4-1-16(2-5-18)22-9-14-7-15(10-22)12-23(11-14,13-22)21(31)30-24(28,29)17-3-6-19(26)20(27)8-17/h1-6,8,14-15H,7,9-13H2,(H,30,31) |
| InChIKey | LVSPSIRHBGYMPX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide?
The IUPAC name of 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide (CID 25000274) is 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide.
What is the SMILES notation for 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide?
The canonical SMILES for 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide is O=C(NC(F)(F)c1ccc(F)c(F)c1)C12CC3CC(C1)CC(c1ccc(Cl)cc1)(C3)C2.
What is the InChIKey of 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide?
The InChIKey is LVSPSIRHBGYMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22ClF4NO/c25-18-4-1-16(2-5-18)22-9-14-7-15(10-22)12-23(11-14,13-22)21(31)30-24(28,29)17-3-6-19(26)20(27)8-17/h1-6,8,14-15H,7,9-13H2,(H,30,31).
What are the key properties of 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide?
3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide has a molecular weight of 451.89 g/mol, XLogP of 6.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-N-[(3,4-difluorophenyl)-difluoromethyl]adamantane-1-carboxamide is sourced from PubChem (CID 25000274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).