C11H20BN3O4S — CID 25000395
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole-1-sulfonamide (PubChem CID 25000395) has the molecular formula C11H20BN3O4S and a molecular weight of 301.18 g/mol. Its IUPAC name is N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole-1-sulfonamide |
|---|---|
| PubChem CID | 25000395 |
| Molecular Formula | C11H20BN3O4S |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)n1cnc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C11H20BN3O4S/c1-10(2)11(3,4)19-12(18-10)9-7-15(8-13-9)20(16,17)14(5)6/h7-8H,1-6H3 |
| InChIKey | ZWQXNFBXPCSFAO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|