C18H33B2N3O5 — CID 25000745
N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazole-1-carboxamide (PubChem CID 25000745) has the molecular formula C18H33B2N3O5 and a molecular weight of 393.10 g/mol. Its IUPAC name is N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazole-1-carboxamide.
| Compound Name | N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazole-1-carboxamide |
|---|---|
| PubChem CID | 25000745 |
| Molecular Formula | C18H33B2N3O5 |
| Molecular Weight | 393.10 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-imidazole-1-carboxamide |
| SMILES | CN(C)C(=O)N1CN(B2OC(C)(C)C(C)(C)O2)C=C1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H33B2N3O5/c1-15(2)16(3,4)26-19(25-15)13-11-22(12-23(13)14(24)21(9)10)20-27-17(5,6)18(7,8)28-20/h11H,12H2,1-10H3 |
| InChIKey | QXXKEGBOEOYFBD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|