C20H24NOP — CID 25001004
(2R,5S)-N,N-diethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine (PubChem CID 25001004) has the molecular formula C20H24NOP and a molecular weight of 325.39 g/mol. Its IUPAC name is (2R,5S)-N,N-diethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine.
| Compound Name | (2R,5S)-N,N-diethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine |
|---|---|
| PubChem CID | 25001004 |
| Molecular Formula | C20H24NOP |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2R,5S)-N,N-diethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine |
| SMILES | CCN(CC)P1(=O)[C@@H](c2ccccc2)C=C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H24NOP/c1-3-21(4-2)23(22)19(17-11-7-5-8-12-17)15-16-20(23)18-13-9-6-10-14-18/h5-16,19-20H,3-4H2,1-2H3/t19-,20+,23? |
| InChIKey | WPDPVLGKZTXZAQ-DETIRCLXSA-N |
| XLogP | 5.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|