C15H19F3N10O2S — CID 25001096
(1R,2S,3R,5R)-3-[5-propylsulfanyl-7-(2,2,2-trifluoroethylamino)triazolo[4,5-d]pyrimidin-3-yl]-5-(2H-tetrazol-5-yl)cyclopentane-1,2-diol (PubChem CID 25001096) has the molecular formula C15H19F3N10O2S and a molecular weight of 460.45 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[5-propylsulfanyl-7-(2,2,2-trifluoroethylamino)triazolo[4,5-d]pyrimidin-3-yl]-5-(2H-tetrazol-5-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[5-propylsulfanyl-7-(2,2,2-trifluoroethylamino)triazolo[4,5-d]pyrimidin-3-yl]-5-(2H-tetrazol-5-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 25001096 |
| Molecular Formula | C15H19F3N10O2S |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (1R,2S,3R,5R)-3-[5-propylsulfanyl-7-(2,2,2-trifluoroethylamino)triazolo[4,5-d]pyrimidin-3-yl]-5-(2H-tetrazol-5-yl)cyclopentane-1,2-diol |
| SMILES | CCCSc1nc(NCC(F)(F)F)c2nnn([C@@H]3C[C@H](c4nn[nH]n4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C15H19F3N10O2S/c1-2-3-31-14-20-12(19-5-15(16,17)18)8-13(21-14)28(27-22-8)7-4-6(9(29)10(7)30)11-23-25-26-24-11/h6-7,9-10,29-30H,2-5H2,1H3,(H,19,20,21)(H,23,24,25,26)/t6-,7+,9+,10-/m0/s1 |
| InChIKey | ZWQYUAZTJDBYCD-WDQPUEAGSA-N |
| XLogP | 0.66 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |