C27H41NO4S2Si — CID 25001340
[(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooct-2-enyl] acetate (PubChem CID 25001340) has the molecular formula C27H41NO4S2Si and a molecular weight of 535.85 g/mol. Its IUPAC name is [(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooct-2-enyl] acetate.
| Compound Name | [(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooct-2-enyl] acetate |
|---|---|
| PubChem CID | 25001340 |
| Molecular Formula | C27H41NO4S2Si |
| Molecular Weight | 535.85 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | [(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(/C)CC[C@@H](CC(=O)N1C(=S)SC[C@@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H41NO4S2Si/c1-20(15-16-31-21(2)29)13-14-24(32-35(6,7)27(3,4)5)18-25(30)28-23(19-34-26(28)33)17-22-11-9-8-10-12-22/h8-12,15,23-24H,13-14,16-19H2,1-7H3/b20-15-/t23-,24-/m0/s1 |
| InChIKey | RSNLMTOIPTZXTG-RGXSRSEKSA-N |
| XLogP | 6.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.85 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|