About 1-ethenoxy-2,6,8-trimethylnonane
1-ethenoxy-2,6,8-trimethylnonane (PubChem CID 25002) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-ethenoxy-2,6,8-trimethylnonane.
Molecular Properties
| Compound Name | 1-ethenoxy-2,6,8-trimethylnonane |
| PubChem CID | 25002 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 1-ethenoxy-2,6,8-trimethylnonane |
| SMILES | C=COCC(C)CCCC(C)CC(C)C |
| InChI | InChI=1S/C14H28O/c1-6-15-11-14(5)9-7-8-13(4)10-12(2)3/h6,12-14H,1,7-11H2,2-5H3 |
| InChIKey | SSOZLSNWPFIHKP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-2,6,8-trimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-2,6,8-trimethylnonane?
The IUPAC name of 1-ethenoxy-2,6,8-trimethylnonane (CID 25002) is 1-ethenoxy-2,6,8-trimethylnonane.
What is the SMILES notation for 1-ethenoxy-2,6,8-trimethylnonane?
The canonical SMILES for 1-ethenoxy-2,6,8-trimethylnonane is C=COCC(C)CCCC(C)CC(C)C.
What is the InChIKey of 1-ethenoxy-2,6,8-trimethylnonane?
The InChIKey is SSOZLSNWPFIHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-6-15-11-14(5)9-7-8-13(4)10-12(2)3/h6,12-14H,1,7-11H2,2-5H3.
What are the key properties of 1-ethenoxy-2,6,8-trimethylnonane?
1-ethenoxy-2,6,8-trimethylnonane has a molecular weight of 212.38 g/mol, XLogP of 4.64, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-2,6,8-trimethylnonane is sourced from PubChem (CID 25002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).