About [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone
[4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 25002414) has the molecular formula C25H25N5O2
and a molecular weight of 427.51 g/mol. Its IUPAC name is [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone.
Molecular Properties
| Compound Name | [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone |
| PubChem CID | 25002414 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | Nc1nc(N)c2c(OCC3CCN(C(=O)c4cccc5ccccc45)CC3)cccc2n1 |
| InChI | InChI=1S/C25H25N5O2/c26-23-22-20(28-25(27)29-23)9-4-10-21(22)32-15-16-11-13-30(14-12-16)24(31)19-8-3-6-17-5-1-2-7-18(17)19/h1-10,16H,11-15H2,(H4,26,27,28,29) |
| InChIKey | QOOMDUSJASDCBP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone?
The IUPAC name of [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone (CID 25002414) is [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone.
What is the SMILES notation for [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone?
The canonical SMILES for [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone is Nc1nc(N)c2c(OCC3CCN(C(=O)c4cccc5ccccc45)CC3)cccc2n1.
What is the InChIKey of [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone?
The InChIKey is QOOMDUSJASDCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N5O2/c26-23-22-20(28-25(27)29-23)9-4-10-21(22)32-15-16-11-13-30(14-12-16)24(31)19-8-3-6-17-5-1-2-7-18(17)19/h1-10,16H,11-15H2,(H4,26,27,28,29).
What are the key properties of [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone?
[4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone has a molecular weight of 427.51 g/mol, XLogP of 3.88, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]-naphthalen-1-ylmethanone is sourced from PubChem (CID 25002414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).