C20H18Cl3NO — CID 25002602
4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one (PubChem CID 25002602) has the molecular formula C20H18Cl3NO and a molecular weight of 394.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one |
|---|---|
| PubChem CID | 25002602 |
| Molecular Formula | C20H18Cl3NO |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2,3,3a,4,5,6,7,7a-octahydroisoindol-1-one |
| SMILES | O=C1NCC2C1CCC(c1ccc(Cl)cc1Cl)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl3NO/c21-12-3-1-11(2-4-12)19-15(14-6-5-13(22)9-18(14)23)7-8-16-17(19)10-24-20(16)25/h1-6,9,15-17,19H,7-8,10H2,(H,24,25) |
| InChIKey | KIYUACPZGGPQPX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |