C23H22Cl3NO — CID 25002949
4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 25002949) has the molecular formula C23H22Cl3NO and a molecular weight of 434.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 25002949 |
| Molecular Formula | C23H22Cl3NO |
| Molecular Weight | 434.79 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | C=CCN1CC2C(CCC(c3ccc(Cl)cc3Cl)C2c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H22Cl3NO/c1-2-11-27-13-20-19(23(27)28)10-9-18(17-8-7-16(25)12-21(17)26)22(20)14-3-5-15(24)6-4-14/h2-8,12,18-20,22H,1,9-11,13H2 |
| InChIKey | YZPDWTFYCGIXLT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|