C24H27Cl3N2O — CID 25002952
4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 25002952) has the molecular formula C24H27Cl3N2O and a molecular weight of 465.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 25002952 |
| Molecular Formula | C24H27Cl3N2O |
| Molecular Weight | 465.85 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | CN(C)CCN1CC2C(CCC(c3ccc(Cl)cc3Cl)C2c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H27Cl3N2O/c1-28(2)11-12-29-14-21-20(24(29)30)10-9-19(18-8-7-17(26)13-22(18)27)23(21)15-3-5-16(25)6-4-15/h3-8,13,19-21,23H,9-12,14H2,1-2H3 |
| InChIKey | BADRSYYCIRJMLU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.85 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |