C20H16Cl3NO — CID 25002953
5-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-2,3,3a,4,5,7a-hexahydroisoindol-1-one (PubChem CID 25002953) has the molecular formula C20H16Cl3NO and a molecular weight of 392.71 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-2,3,3a,4,5,7a-hexahydroisoindol-1-one.
| Compound Name | 5-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 25002953 |
| Molecular Formula | C20H16Cl3NO |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(2,4-dichlorophenyl)-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
| SMILES | O=C1NCC2C1C=CC(c1ccc(Cl)cc1)C2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl3NO/c21-12-3-1-11(2-4-12)14-7-8-15-17(10-24-20(15)25)19(14)16-6-5-13(22)9-18(16)23/h1-9,14-15,17,19H,10H2,(H,24,25) |
| InChIKey | KEQGRDYAZWVLLL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|