C14H11ClFN3O3 — CID 25003192
6-[(3-chloro-4-fluorophenyl)methylcarbamoyl]-5-methylpyrimidine-4-carboxylic acid (PubChem CID 25003192) has the molecular formula C14H11ClFN3O3 and a molecular weight of 323.71 g/mol. Its IUPAC name is 6-[(3-chloro-4-fluorophenyl)methylcarbamoyl]-5-methylpyrimidine-4-carboxylic acid.
| Compound Name | 6-[(3-chloro-4-fluorophenyl)methylcarbamoyl]-5-methylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 25003192 |
| Molecular Formula | C14H11ClFN3O3 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 6-[(3-chloro-4-fluorophenyl)methylcarbamoyl]-5-methylpyrimidine-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)ncnc1C(=O)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClFN3O3/c1-7-11(18-6-19-12(7)14(21)22)13(20)17-5-8-2-3-10(16)9(15)4-8/h2-4,6H,5H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | FZWYYDPKYMYRKI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |