C16H22N2O6 — CID 25003230
methyl 4-[[(2R,3R)-4-(benzylamino)-2,3-dihydroxy-4-oxobutanoyl]amino]butanoate (PubChem CID 25003230) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl 4-[[(2R,3R)-4-(benzylamino)-2,3-dihydroxy-4-oxobutanoyl]amino]butanoate.
| Compound Name | methyl 4-[[(2R,3R)-4-(benzylamino)-2,3-dihydroxy-4-oxobutanoyl]amino]butanoate |
|---|---|
| PubChem CID | 25003230 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | methyl 4-[[(2R,3R)-4-(benzylamino)-2,3-dihydroxy-4-oxobutanoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O6/c1-24-12(19)8-5-9-17-15(22)13(20)14(21)16(23)18-10-11-6-3-2-4-7-11/h2-4,6-7,13-14,20-21H,5,8-10H2,1H3,(H,17,22)(H,18,23)/t13-,14-/m1/s1 |
| InChIKey | MRCDLESHORHGLW-ZIAGYGMSSA-N |
| XLogP | -0.91 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|