C21H20Cl3NO — CID 25003307
4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 25003307) has the molecular formula C21H20Cl3NO and a molecular weight of 408.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 25003307 |
| Molecular Formula | C21H20Cl3NO |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | CN1CC2C(CCC(c3ccc(Cl)cc3Cl)C2c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C21H20Cl3NO/c1-25-11-18-17(21(25)26)9-8-16(15-7-6-14(23)10-19(15)24)20(18)12-2-4-13(22)5-3-12/h2-7,10,16-18,20H,8-9,11H2,1H3 |
| InChIKey | BXSQQIMVGRLVNN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |