C28H29ClN4O — CID 25003426
N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]-6-methoxyquinolin-4-amine (PubChem CID 25003426) has the molecular formula C28H29ClN4O and a molecular weight of 473.02 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]-6-methoxyquinolin-4-amine.
| Compound Name | N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]-6-methoxyquinolin-4-amine |
|---|---|
| PubChem CID | 25003426 |
| Molecular Formula | C28H29ClN4O |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[(4-chlorophenyl)-[4-(piperazin-1-ylmethyl)phenyl]methyl]-6-methoxyquinolin-4-amine |
| SMILES | COc1ccc2nccc(NC(c3ccc(Cl)cc3)c3ccc(CN4CCNCC4)cc3)c2c1 |
| InChI | InChI=1S/C28H29ClN4O/c1-34-24-10-11-26-25(18-24)27(12-13-31-26)32-28(22-6-8-23(29)9-7-22)21-4-2-20(3-5-21)19-33-16-14-30-15-17-33/h2-13,18,28,30H,14-17,19H2,1H3,(H,31,32) |
| InChIKey | DSUUUZZSLONMHI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |