About (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile
(E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile (PubChem CID 25003466) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile.
Molecular Properties
| Compound Name | (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile |
| PubChem CID | 25003466 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile |
| SMILES | CC1=CC[C@@H](C/C=C/CCC#N)C1(C)C |
| InChI | InChI=1S/C14H21N/c1-12-9-10-13(14(12,2)3)8-6-4-5-7-11-15/h4,6,9,13H,5,7-8,10H2,1-3H3/b6-4+/t13-/m1/s1 |
| InChIKey | HEJSAKROAFFXKZ-DIECRNLCSA-N |
| XLogP | 4.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile?
The IUPAC name of (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile (CID 25003466) is (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile.
What is the SMILES notation for (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile?
The canonical SMILES for (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile is CC1=CC[C@@H](C/C=C/CCC#N)C1(C)C.
What is the InChIKey of (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile?
The InChIKey is HEJSAKROAFFXKZ-DIECRNLCSA-N. The full InChI is InChI=1S/C14H21N/c1-12-9-10-13(14(12,2)3)8-6-4-5-7-11-15/h4,6,9,13H,5,7-8,10H2,1-3H3/b6-4+/t13-/m1/s1.
What are the key properties of (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile?
(E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile has a molecular weight of 203.33 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]hex-4-enenitrile is sourced from PubChem (CID 25003466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).