About (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile
(Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile (PubChem CID 25003472) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile.
Molecular Properties
| Compound Name | (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile |
| PubChem CID | 25003472 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile |
| SMILES | CC1=CCC(C/C=C(/C)CCC#N)C1(C)C |
| InChI | InChI=1S/C15H23N/c1-12(6-5-11-16)7-9-14-10-8-13(2)15(14,3)4/h7-8,14H,5-6,9-10H2,1-4H3/b12-7- |
| InChIKey | AZDPQCUMJKQEQL-GHXNOFRVSA-N |
| XLogP | 4.62 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile?
The IUPAC name of (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile (CID 25003472) is (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile.
What is the SMILES notation for (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile?
The canonical SMILES for (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile is CC1=CCC(C/C=C(/C)CCC#N)C1(C)C.
What is the InChIKey of (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile?
The InChIKey is AZDPQCUMJKQEQL-GHXNOFRVSA-N. The full InChI is InChI=1S/C15H23N/c1-12(6-5-11-16)7-9-14-10-8-13(2)15(14,3)4/h7-8,14H,5-6,9-10H2,1-4H3/b12-7-.
What are the key properties of (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile?
(Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile has a molecular weight of 217.36 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-4-enenitrile is sourced from PubChem (CID 25003472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).