C20H21F2N5O3S — CID 25003476
5-[[4-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methoxy]quinazoline-2,4-diamine (PubChem CID 25003476) has the molecular formula C20H21F2N5O3S and a molecular weight of 449.48 g/mol. Its IUPAC name is 5-[[4-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methoxy]quinazoline-2,4-diamine.
| Compound Name | 5-[[4-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methoxy]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 25003476 |
| Molecular Formula | C20H21F2N5O3S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 5-[[4-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]methoxy]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2c(OCC3(S(=O)(=O)c4ccc(F)cc4F)CCNCC3)cccc2n1 |
| InChI | InChI=1S/C20H21F2N5O3S/c21-12-4-5-16(13(22)10-12)31(28,29)20(6-8-25-9-7-20)11-30-15-3-1-2-14-17(15)18(23)27-19(24)26-14/h1-5,10,25H,6-9,11H2,(H4,23,24,26,27) |
| InChIKey | FFABNFBIXOLUQB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |