C29H29N7 — CID 25003600
2-ethyl-5,7-dimethyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine (PubChem CID 25003600) has the molecular formula C29H29N7 and a molecular weight of 475.60 g/mol. Its IUPAC name is 2-ethyl-5,7-dimethyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-ethyl-5,7-dimethyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 25003600 |
| Molecular Formula | C29H29N7 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-ethyl-5,7-dimethyl-3-[[(2E)-2-[1-(2H-tetrazol-5-yl)ethylidene]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc2c(c1)CCc1ccccc1/C2=C(/C)c1nn[nH]n1 |
| InChI | InChI=1S/C29H29N7/c1-5-25-31-27-17(2)14-18(3)30-29(27)36(25)16-20-10-13-24-22(15-20)12-11-21-8-6-7-9-23(21)26(24)19(4)28-32-34-35-33-28/h6-10,13-15H,5,11-12,16H2,1-4H3,(H,32,33,34,35)/b26-19+ |
| InChIKey | VJRUFEVPBAFDQS-LGUFXXKBSA-N |
| XLogP | 5.25 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|