C25H25Cl3N2O2 — CID 25003659
5-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]pyrrolidin-2-one (PubChem CID 25003659) has the molecular formula C25H25Cl3N2O2 and a molecular weight of 491.85 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]pyrrolidin-2-one.
| Compound Name | 5-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 25003659 |
| Molecular Formula | C25H25Cl3N2O2 |
| Molecular Weight | 491.85 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 5-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(C(=O)N2CC3CCC(c4ccc(Cl)cc4Cl)C(c4ccc(Cl)cc4)C3C2)N1 |
| InChI | InChI=1S/C25H25Cl3N2O2/c26-16-4-1-14(2-5-16)24-19(18-8-6-17(27)11-21(18)28)7-3-15-12-30(13-20(15)24)25(32)22-9-10-23(31)29-22/h1-2,4-6,8,11,15,19-20,22,24H,3,7,9-10,12-13H2,(H,29,31) |
| InChIKey | BWWLRTFVCZHMME-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.85 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |