C27H34N3O4+ — CID 25003870
2-(4-carbamoylphenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium (PubChem CID 25003870) has the molecular formula C27H34N3O4+ and a molecular weight of 464.59 g/mol. Its IUPAC name is 2-(4-carbamoylphenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium.
| Compound Name | 2-(4-carbamoylphenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 25003870 |
| Molecular Formula | C27H34N3O4+ |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2-(4-carbamoylphenoxy)ethyl-[[2-(cyclopentyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl]-dimethylazanium |
| SMILES | C[N+](C)(CCOc1ccc(C(N)=O)cc1)Cc1cnc(C(O)(c2ccccc2)C2CCCC2)o1 |
| InChI | InChI=1S/C27H33N3O4/c1-30(2,16-17-33-23-14-12-20(13-15-23)25(28)31)19-24-18-29-26(34-24)27(32,22-10-6-7-11-22)21-8-4-3-5-9-21/h3-5,8-9,12-15,18,22,32H,6-7,10-11,16-17,19H2,1-2H3,(H-,28,31)/p+1 |
| InChIKey | PXEJCVUGSNLRHU-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|