C20H19Cl3N2 — CID 25004364
4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-amine (PubChem CID 25004364) has the molecular formula C20H19Cl3N2 and a molecular weight of 393.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-amine.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-amine |
|---|---|
| PubChem CID | 25004364 |
| Molecular Formula | C20H19Cl3N2 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-amine |
| SMILES | NC1=NCC2C1CCC(c1ccc(Cl)cc1Cl)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19Cl3N2/c21-12-3-1-11(2-4-12)19-15(14-6-5-13(22)9-18(14)23)7-8-16-17(19)10-25-20(16)24/h1-6,9,15-17,19H,7-8,10H2,(H2,24,25) |
| InChIKey | QVALQIWGSOCAOX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |